EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43BrN4O6 |
| Net Charge | 0 |
| Average Mass | 695.655 |
| Monoisotopic Mass | 694.23660 |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)C[C@H](c2ccc(O)cc2)NC(=O)[C@@H](Cc2c(Br)nc3ccccc23)N(C)C(=O)[C@H](C)NC(=O)CC1 |
| InChI | InChI=1S/C35H43BrN4O6/c1-20-10-15-31(42)37-23(4)35(45)40(5)30(18-27-26-8-6-7-9-28(26)38-33(27)36)34(44)39-29(24-11-13-25(41)14-12-24)19-32(43)46-22(3)17-21(2)16-20/h6-9,11-14,16,21-23,29-30,38,41H,10,15,17-19H2,1-5H3,(H,37,42)(H,39,44)/b20-16+/t21-,22-,23-,29+,30+/m0/s1 |
| InChIKey | JCKVLCSMPHMFGK-CBRUVUFKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | |||
| - | DOI (10.1016/j.tet.2008.05.037) | ||
| - | PubMed (21241058) | Methanolic extract of sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. actin polymerisation inhibitor Any substance that inhibits the polymerisation of the protein actin. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaspamide J (CHEBI:66114) has role actin polymerisation inhibitor (CHEBI:70728) |
| jaspamide J (CHEBI:66114) has role animal metabolite (CHEBI:75767) |
| jaspamide J (CHEBI:66114) has role antineoplastic agent (CHEBI:35610) |
| jaspamide J (CHEBI:66114) has role marine metabolite (CHEBI:76507) |
| jaspamide J (CHEBI:66114) is a cyclodepsipeptide (CHEBI:35213) |
| jaspamide J (CHEBI:66114) is a macrocycle (CHEBI:51026) |
| jaspamide J (CHEBI:66114) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (4R,7R,10S,15E,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,15,17,19-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| Synonym | Source |
|---|---|
| jaspakinolide J | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 25034011 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18557796 | Reaxys |
| Citations |
|---|