EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45BrN4O7 |
| Net Charge | 0 |
| Average Mass | 725.681 |
| Monoisotopic Mass | 724.24716 |
| SMILES | C[C@@H]1NC(=O)[C@@H](C)C/C(CO)=C/[C@H](C)C[C@H](C)OC(=O)C[C@H](c2ccc(O)cc2)NC(=O)[C@@H](Cc2c(Br)nc3ccccc23)N(C)C1=O |
| InChI | InChI=1S/C36H45BrN4O7/c1-20-14-22(3)48-32(44)18-30(25-10-12-26(43)13-11-25)40-35(46)31(17-28-27-8-6-7-9-29(27)39-33(28)37)41(5)36(47)23(4)38-34(45)21(2)16-24(15-20)19-42/h6-13,15,20-23,30-31,39,42-43H,14,16-19H2,1-5H3,(H,38,45)(H,40,46)/b24-15-/t20-,21+,22+,23+,30-,31-/m1/s1 |
| InChIKey | NNVOUTYROAINIX-UJGTXQDTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | DOI (10.1016/j.tet.2008.05.037) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. actin polymerisation inhibitor Any substance that inhibits the polymerisation of the protein actin. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaspamide L (CHEBI:66113) has role actin polymerisation inhibitor (CHEBI:70728) |
| jaspamide L (CHEBI:66113) has role antineoplastic agent (CHEBI:35610) |
| jaspamide L (CHEBI:66113) has role metabolite (CHEBI:25212) |
| jaspamide L (CHEBI:66113) is a cyclodepsipeptide (CHEBI:35213) |
| jaspamide L (CHEBI:66113) is a macrocycle (CHEBI:51026) |
| jaspamide L (CHEBI:66113) is a organobromine compound (CHEBI:37141) |
| jaspamide L (CHEBI:66113) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15Z,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-15-(hydroxymethyl)-4-(4-hydroxyphenyl)-8,10,13,17,19-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18557799 | Reaxys |