EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43BrN4O6 |
| Net Charge | 0 |
| Average Mass | 695.655 |
| Monoisotopic Mass | 694.23660 |
| SMILES | [H]C1/C=C(\C)C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2c(Br)nc3ccccc23)C(=O)N[C@@H](c2ccc(O)cc2)CC(=O)O[C@@H](C)C1 |
| InChI | InChI=1S/C35H43BrN4O6/c1-20-9-8-10-22(3)46-31(42)19-29(24-13-15-25(41)16-14-24)39-34(44)30(18-27-26-11-6-7-12-28(26)38-32(27)36)40(5)35(45)23(4)37-33(43)21(2)17-20/h6-7,9,11-16,21-23,29-30,38,41H,8,10,17-19H2,1-5H3,(H,37,43)(H,39,44)/b20-9+/t21-,22-,23-,29+,30+/m0/s1 |
| InChIKey | RDBNISBUPIBNGP-RAMWEYKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | DOI (10.1016/j.tet.2008.05.037) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | actin polymerisation inhibitor Any substance that inhibits the polymerisation of the protein actin. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaspamide H (CHEBI:66111) has role actin polymerisation inhibitor (CHEBI:70728) |
| jaspamide H (CHEBI:66111) has role animal metabolite (CHEBI:75767) |
| jaspamide H (CHEBI:66111) has role antineoplastic agent (CHEBI:35610) |
| jaspamide H (CHEBI:66111) has role marine metabolite (CHEBI:76507) |
| jaspamide H (CHEBI:66111) is a cyclodepsipeptide (CHEBI:35213) |
| jaspamide H (CHEBI:66111) is a macrocycle (CHEBI:51026) |
| jaspamide H (CHEBI:66111) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15E,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,13,15,19-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |