EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45BrN4O7 |
| Net Charge | 0 |
| Average Mass | 725.681 |
| Monoisotopic Mass | 724.24716 |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)C[C@H](c2ccc(O)cc2)NC(=O)[C@@H](Cc2c(Br)nc3ccccc23)N(C)C(=O)[C@H](CO)NC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C36H45BrN4O7/c1-20-14-21(2)16-23(4)48-32(44)18-29(24-10-12-25(43)13-11-24)39-35(46)31(17-27-26-8-6-7-9-28(26)38-33(27)37)41(5)36(47)30(19-42)40-34(45)22(3)15-20/h6-14,21-23,29-31,38,42-43H,15-19H2,1-5H3,(H,39,46)(H,40,45)/b20-14+/t21-,22-,23-,29+,30-,31+/m0/s1 |
| InChIKey | DHQOFPFBUAFCRJ-GFUVCHAISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | DOI (10.1016/j.tet.2007.03.162) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaspamide E (CHEBI:66108) has role animal metabolite (CHEBI:75767) |
| jaspamide E (CHEBI:66108) has role antineoplastic agent (CHEBI:35610) |
| jaspamide E (CHEBI:66108) has role marine metabolite (CHEBI:76507) |
| jaspamide E (CHEBI:66108) is a cyclodepsipeptide (CHEBI:35213) |
| jaspamide E (CHEBI:66108) is a macrocycle (CHEBI:51026) |
| jaspamide E (CHEBI:66108) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15E,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-10-(hydroxymethyl)-4-(4-hydroxyphenyl)-8,13,15,17,19-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11016306 | Reaxys |