EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45BrN4O7 |
| Net Charge | 0 |
| Average Mass | 725.681 |
| Monoisotopic Mass | 724.24716 |
| SMILES | C=C1C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2c(Br)nc3ccccc23)C(=O)N[C@@H](c2ccc(O)cc2)CC(=O)O[C@@H](C)C[C@@H](C)C1O |
| InChI | InChI=1S/C36H45BrN4O7/c1-19-15-21(3)34(45)38-23(5)36(47)41(6)30(17-27-26-9-7-8-10-28(26)39-33(27)37)35(46)40-29(24-11-13-25(42)14-12-24)18-31(43)48-22(4)16-20(2)32(19)44/h7-14,20-23,29-30,32,39,42,44H,1,15-18H2,2-6H3,(H,38,45)(H,40,46)/t20-,21+,22+,23+,29-,30-,32?/m1/s1 |
| InChIKey | BJPMREHPIFRLGM-KALUOVLNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | - | PubMed (10075778) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaspamide C (CHEBI:66106) has role animal metabolite (CHEBI:75767) |
| jaspamide C (CHEBI:66106) has role antineoplastic agent (CHEBI:35610) |
| jaspamide C (CHEBI:66106) has role marine metabolite (CHEBI:76507) |
| jaspamide C (CHEBI:66106) is a cyclodepsipeptide (CHEBI:35213) |
| jaspamide C (CHEBI:66106) is a macrocycle (CHEBI:51026) |
| jaspamide C (CHEBI:66106) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-16-hydroxy-4-(4-hydroxyphenyl)-8,10,13,17,19-pentamethyl-15-methylidene-1-oxa-5,8,11-triazacyclononadecane-2,6,9,12-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8684509 | ChemSpider |
| Citations |
|---|