EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45BrN4O6 |
| Net Charge | 0 |
| Average Mass | 709.682 |
| Monoisotopic Mass | 708.25225 |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)C[C@H](c2ccc(O)cc2)NC(=O)[C@@H](Cc2c(Br)nc3ccccc23)N(C)C(=O)[C@H](C)NC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C36H45BrN4O6/c1-20-15-21(2)17-23(4)47-32(43)19-30(25-11-13-26(42)14-12-25)40-35(45)31(18-28-27-9-7-8-10-29(27)39-33(28)37)41(6)36(46)24(5)38-34(44)22(3)16-20/h7-15,21-24,30-31,39,42H,16-19H2,1-6H3,(H,38,44)(H,40,45)/b20-15+/t21-,22-,23-,24-,30+,31+/m0/s1 |
| InChIKey | GQWYWHOHRVVHAP-DHKPLNAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | |||
| - | DOI (10.1016/j.tet.2008.05.037) | ||
| - | PubMed (21241058) | Methanolic extract of sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | actin polymerisation inducer Any substance that induces the polymerisation of the protein actin. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaspamide (CHEBI:66104) has role actin polymerisation inducer (CHEBI:176495) |
| jaspamide (CHEBI:66104) has role animal metabolite (CHEBI:75767) |
| jaspamide (CHEBI:66104) has role antifungal agent (CHEBI:35718) |
| jaspamide (CHEBI:66104) has role antineoplastic agent (CHEBI:35610) |
| jaspamide (CHEBI:66104) has role apoptosis inducer (CHEBI:68495) |
| jaspamide (CHEBI:66104) has role marine metabolite (CHEBI:76507) |
| jaspamide (CHEBI:66104) has role neuroprotective agent (CHEBI:63726) |
| jaspamide (CHEBI:66104) is a cyclodepsipeptide (CHEBI:35213) |
| jaspamide (CHEBI:66104) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15E,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| Synonyms | Source |
|---|---|
| beta-Alanine, N-(2-bromo-N-(N-(8-hydroxy-2,4,6-trimethyl-1-oxo-4-nonenyl)-L-alanyl)-N-methyl-D-tryptophyl)-L-3-(4-hydroxyphenyl)-, p-lactone, (2S-(2R*,4E,6S*,8R*))- | ChemIDplus |
| Jaspamide | ChemIDplus |
| (+)-Jasplakinolide | KNApSAcK |
| Jasplakinolide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00026975 | KNApSAcK |
| C16883 | KEGG COMPOUND |
| KR20030085421 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4649870 | Reaxys |
| CAS:102396-24-7 | ChemIDplus |
| CAS:102396-24-7 | KEGG COMPOUND |
| Citations |
|---|