EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H45BrN4O6 |
| Net Charge | 0 |
| Average Mass | 709.682 |
| Monoisotopic Mass | 708.25225 |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)C[C@H](c2ccc(O)cc2)NC(=O)[C@@H](Cc2c(Br)nc3ccccc23)N(C)C(=O)[C@H](C)NC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C36H45BrN4O6/c1-20-15-21(2)17-23(4)47-32(43)19-30(25-11-13-26(42)14-12-25)40-35(45)31(18-28-27-9-7-8-10-29(27)39-33(28)37)41(6)36(46)24(5)38-34(44)22(3)16-20/h7-15,21-24,30-31,39,42H,16-19H2,1-6H3,(H,38,44)(H,40,45)/b20-15+/t21-,22-,23-,24-,30+,31+/m0/s1 |
| InChIKey | GQWYWHOHRVVHAP-DHKPLNAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jaspis splendens (WORMS:169842) | |||
| - | DOI (10.1016/j.tet.2008.05.037) | ||
| - | PubMed (21241058) | Methanolic extract of sponge |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. actin polymerisation inducer Any substance that induces the polymerisation of the protein actin. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaspamide (CHEBI:66104) has role actin polymerisation inducer (CHEBI:176495) |
| jaspamide (CHEBI:66104) has role animal metabolite (CHEBI:75767) |
| jaspamide (CHEBI:66104) has role antifungal agent (CHEBI:35718) |
| jaspamide (CHEBI:66104) has role antineoplastic agent (CHEBI:35610) |
| jaspamide (CHEBI:66104) has role apoptosis inducer (CHEBI:68495) |
| jaspamide (CHEBI:66104) has role marine metabolite (CHEBI:76507) |
| jaspamide (CHEBI:66104) has role neuroprotective agent (CHEBI:63726) |
| jaspamide (CHEBI:66104) is a cyclodepsipeptide (CHEBI:35213) |
| jaspamide (CHEBI:66104) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15E,17R,19S)-7-[(2-bromo-1H-indol-3-yl)methyl]-4-(4-hydroxyphenyl)-8,10,13,15,17,19-hexamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| Synonyms | Source |
|---|---|
| beta-Alanine, N-(2-bromo-N-(N-(8-hydroxy-2,4,6-trimethyl-1-oxo-4-nonenyl)-L-alanyl)-N-methyl-D-tryptophyl)-L-3-(4-hydroxyphenyl)-, p-lactone, (2S-(2R*,4E,6S*,8R*))- | ChemIDplus |
| Jaspamide | ChemIDplus |
| (+)-Jasplakinolide | KNApSAcK |
| Jasplakinolide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00026975 | KNApSAcK |
| C16883 | KEGG COMPOUND |
| KR20030085421 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4649870 | Reaxys |
| CAS:102396-24-7 | ChemIDplus |
| CAS:102396-24-7 | KEGG COMPOUND |
| Citations |
|---|