EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)ccc1O |
| InChI | InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
| InChIKey | GLAAQZFBFGEBPS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia argyi (ncbitaxon:259893) | - | DOI (10.1016/j.jep.2005.01.054) | |
| Salvia tomentosa (IPNI:457405-1) | - | DOI (10.1021/np50003a002) | |
| Helenium alternifolium (IPNI:211741-1) | aerial part (BTO:0001658) | DOI (10.1021/jo01271a036) | |
| Plummera ambigens (IPNI:238918-1) | - | DOI (10.1016/0305-1978(78)90048-0) | |
| Artemisia copa (ncbitaxon:927720) | - | PubMed (16450301) | |
| Santolina chamaecyparissus (ncbitaxon:41644) | aerial part (BTO:0001658) | DOI (10.1055/s-2008-1074873) | |
| Artemisia asiatica (IPNI:179234-1) | - | PubMed (17404061) | |
| Helichrysum viscosum (IPNI:213476-1) | aerial part (BTO:0001658) | DOI (10.1016/S0031-9422(00)82953-2) | |
| Artemisia princeps (ncbitaxon:223870) | - | PubMed (17996677) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaceosidin (CHEBI:66103) has role anti-allergic agent (CHEBI:50857) |
| jaceosidin (CHEBI:66103) has role anti-inflammatory agent (CHEBI:67079) |
| jaceosidin (CHEBI:66103) has role antineoplastic agent (CHEBI:35610) |
| jaceosidin (CHEBI:66103) has role apoptosis inducer (CHEBI:68495) |
| jaceosidin (CHEBI:66103) has role metabolite (CHEBI:25212) |
| jaceosidin (CHEBI:66103) is a dimethoxyflavone (CHEBI:23798) |
| jaceosidin (CHEBI:66103) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-1-Benzopyran-4-one | ChEBI |
| 4',5,7-trihydroxy-3',6-dimethoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12111235 | LIPID MAPS |
| CN102697767 | Patent |
| KR20060121623 | Patent |
| KR20090079608 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1265265 | Reaxys |
| CAS:18085-97-7 | ChemIDplus |
| Citations |
|---|