EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)ccc1O |
| InChI | InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
| InChIKey | GLAAQZFBFGEBPS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia argyi (ncbitaxon:259893) | - | DOI (10.1016/j.jep.2005.01.054) | |
| Artemisia asiatica (IPNI:179234-1) | - | PubMed (17404061) | |
| Artemisia copa (ncbitaxon:927720) | - | PubMed (16450301) | |
| Artemisia princeps (ncbitaxon:223870) | - | PubMed (17996677) | |
| Helenium alternifolium (IPNI:211741-1) | aerial part (BTO:0001658) | DOI (10.1021/jo01271a036) | |
| Helichrysum viscosum (IPNI:213476-1) | aerial part (BTO:0001658) | DOI (10.1016/S0031-9422(00)82953-2) | |
| Plummera ambigens (IPNI:238918-1) | - | DOI (10.1016/0305-1978(78)90048-0) | |
| Salvia tomentosa (IPNI:457405-1) | - | DOI (10.1021/np50003a002) | |
| Santolina chamaecyparissus (ncbitaxon:41644) | aerial part (BTO:0001658) | DOI (10.1055/s-2008-1074873) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-allergic agent A drug used to treat allergic reactions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jaceosidin (CHEBI:66103) has role anti-allergic agent (CHEBI:50857) |
| jaceosidin (CHEBI:66103) has role anti-inflammatory agent (CHEBI:67079) |
| jaceosidin (CHEBI:66103) has role antineoplastic agent (CHEBI:35610) |
| jaceosidin (CHEBI:66103) has role apoptosis inducer (CHEBI:68495) |
| jaceosidin (CHEBI:66103) has role metabolite (CHEBI:25212) |
| jaceosidin (CHEBI:66103) is a dimethoxyflavone (CHEBI:23798) |
| jaceosidin (CHEBI:66103) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',5,7-trihydroxy-3',6-dimethoxyflavone | ChEBI |
| 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-1-Benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN102697767 | Patent |
| KR20060121623 | Patent |
| KR20090079608 | Patent |
| LMPK12111235 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1265265 | Reaxys |
| CAS:18085-97-7 | ChemIDplus |
| Citations |
|---|