EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H28O12 |
| Net Charge | 0 |
| Average Mass | 652.608 |
| Monoisotopic Mass | 652.15808 |
| SMILES | CC1(C)C=Cc2c(cc(O)c3c(=O)c4ccc(O[C@@H]5c6c(cc(O)c7c(=O)c8cccc(O)c8oc67)O[C@H]5C(C)(C)O)c(O)c4oc23)O1 |
| InChI | InChI=1S/C36H28O12/c1-35(2)11-10-14-21(48-35)12-18(38)23-27(41)16-8-9-20(28(42)31(16)47-30(14)23)44-33-25-22(45-34(33)36(3,4)43)13-19(39)24-26(40)15-6-5-7-17(37)29(15)46-32(24)25/h5-13,33-34,37-39,42-43H,1-4H3/t33-,34-/m1/s1 |
| InChIKey | PESVSEKBWYZQFT-KKLWWLSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum japonicum (ncbitaxon:282542) | - | PubMed (11914965) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jacarelhyperol B (CHEBI:66102) has role plant metabolite (CHEBI:76924) |
| jacarelhyperol B (CHEBI:66102) is a polyphenol (CHEBI:26195) |
| jacarelhyperol B (CHEBI:66102) is a pyranoxanthones (CHEBI:71238) |
| IUPAC Name |
|---|
| rel-10-{[(1R,2R)-5,10-dihydroxy-2-(2-hydroxypropan-2-yl)-6-oxo-1,2-dihydro-6H-furo[2,3-c]xanthen-1-yl]oxy}-6,11-dihydroxy-3,3-dimethyl-3H,7H-pyrano[2,3-c]xanthen-7-one |
| Synonym | Source |
|---|---|
| rel-10-{[(1S,2S)-1,2-dihydro-5,10-dihydroxy-2-(1-hydroxy-1-methylethyl)-6-oxo-6H-furo[2,3-c]xanthene-1-yl]oxy}-6,11-dihydroxy-3,3-dimethyl-3H,7H-pyrano[2,3-c]xanthen-7-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9465637 | Reaxys |
| Citations |
|---|