EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CC(C)(O)CCc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| InChI | InChI=1S/C20H20O6/c1-20(2,25)6-5-12-7-11(3-4-15(12)22)14-10-26-17-9-13(21)8-16(23)18(17)19(14)24/h3-4,7-10,21-23,25H,5-6H2,1-2H3 |
| InChIKey | BWCOGZMVRBYAKY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brosimum utile (ncbitaxon:241871) | root (BTO:0001188) | PubMed (15938138) | Previous component: root bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isowigtheone hydrate (CHEBI:66099) has role antineoplastic agent (CHEBI:35610) |
| isowigtheone hydrate (CHEBI:66099) has role metabolite (CHEBI:25212) |
| isowigtheone hydrate (CHEBI:66099) is a 7-hydroxyisoflavones (CHEBI:55465) |
| isowigtheone hydrate (CHEBI:66099) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-[4-hydroxy-3-(3-hydroxy-3-methylbutyl)phenyl]-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 5,7,4'-trihydroxy-3'-(3-hydroxy-3-methylbutyl)isoflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 21376731 | ChemSpider |
| Citations |
|---|