EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O3 |
| Net Charge | 0 |
| Average Mass | 422.609 |
| Monoisotopic Mass | 422.28210 |
| SMILES | [H][C@@]12C[C@@H](CO)CC[C@]1(C)CC[C@]1(C)C3=CC=C4C(=CC(=O)C(O)=C4C)[C@]3(C)CC[C@@]21C |
| InChI | InChI=1S/C28H38O3/c1-17-19-6-7-22-26(3,20(19)15-21(30)24(17)31)11-13-28(5)23-14-18(16-29)8-9-25(23,2)10-12-27(22,28)4/h6-7,15,18,23,29,31H,8-14,16H2,1-5H3/t18-,23+,25+,26-,27+,28-/m0/s1 |
| InChIKey | RRKSDDREVOXSJD-TXARQUJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salacia madagascariensis (ncbitaxon:670374) | root (BTO:0001188) | PubMed (15730255) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-epi-isoiguesterinol (CHEBI:66095) has role antileishmanial agent (CHEBI:70868) |
| 20-epi-isoiguesterinol (CHEBI:66095) has role metabolite (CHEBI:25212) |
| 20-epi-isoiguesterinol (CHEBI:66095) is a enol (CHEBI:33823) |
| 20-epi-isoiguesterinol (CHEBI:66095) is a enone (CHEBI:51689) |
| 20-epi-isoiguesterinol (CHEBI:66095) is a pentacyclic triterpenoid (CHEBI:25872) |
| 20-epi-isoiguesterinol (CHEBI:66095) is a primary alcohol (CHEBI:15734) |
| 20-epi-isoiguesterinol (CHEBI:66095) is a quinomethanes (CHEBI:52404) |
| IUPAC Name |
|---|
| (6bS,8aR,11S,12aR,12bS,14aR)-3-hydroxy-11-(hydroxymethyl)-4,6b,8a,12b,14a-pentamethyl-7,8,8a,9,10,11,12,12a,12b,13,14,14a-dodecahydropicen-2(6bH)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15768954 | Reaxys |
| Citations |
|---|