EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C61H45Cl6N7O15 |
| Net Charge | 0 |
| Average Mass | 1328.783 |
| Monoisotopic Mass | 1325.11048 |
| SMILES | CN1C(=O)[C@@H](c2cc(Cl)c(O)c(Cl)c2)NC(=O)[C@@H]2NC(=O)[C@@H](c3cc(Cl)c(O)c(Cl)c3)NC(=O)[C@H](NC(=O)C(=O)c3cc(Cl)c(O)c(Cl)c3)Cc3cnc4cc(ccc34)-c3cc2cc(c3O)Oc2ccc(cc2)C[C@H]1C(=O)N[C@@H](C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C61H45Cl6N7O15/c1-74-44(56(82)73-49(61(87)88)25-4-7-32(75)8-5-25)12-24-2-9-33(10-3-24)89-45-22-27-13-35(51(45)77)26-6-11-34-31(23-68-42(34)20-26)21-43(69-59(85)50(76)30-18-40(66)54(80)41(67)19-30)55(81)70-47(28-14-36(62)52(78)37(63)15-28)57(83)71-46(27)58(84)72-48(60(74)86)29-16-38(64)53(79)39(65)17-29/h2-11,13-20,22-23,43-44,46-49,68,75,77-80H,12,21H2,1H3,(H,69,85)(H,70,81)(H,71,83)(H,72,84)(H,73,82)(H,87,88)/t43-,44+,46-,47-,48-,49-/m1/s1 |
| InChIKey | JJGZGELTZPACID-OTLJHNKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (11473415) | axial-chiral isomer of complestatin |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocomplestatin (CHEBI:66093) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| isocomplestatin (CHEBI:66093) has role metabolite (CHEBI:25212) |
| isocomplestatin (CHEBI:66093) is a cyclic ether (CHEBI:37407) |
| isocomplestatin (CHEBI:66093) is a heterodetic cyclic peptide (CHEBI:24533) |
| isocomplestatin (CHEBI:66093) is a organic heterobicyclic compound (CHEBI:27171) |
| isocomplestatin (CHEBI:66093) is a organochlorine compound (CHEBI:36683) |
| isocomplestatin (CHEBI:66093) is a polyphenol (CHEBI:26195) |
| Synonym | Source |
|---|---|
| (2R)-({[(17R,20R,23R,26R,29S)-20,26-bis(3,5-dichloro-4-hydroxyphenyl)-17-{[(3,5-dichloro-4-hydroxyphenyl)(oxo)acetyl]amino}-37-hydroxy-28-methyl-18,21,24,27-tetraoxo-2-oxa-13,19,22,25,28-pentaazahexacyclo[29.2.2.13,7.18,12.05,23.011,15]heptatriaconta-1(33),3(37),4,6,8(36),9,11,14,31,34-decaen-29-yl]carbonyl}amino)(4-hydroxyphenyl)acetic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 10213850 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7913183 | Reaxys |
| Citations |
|---|