EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H24O5 |
| Net Charge | 0 |
| Average Mass | 452.506 |
| Monoisotopic Mass | 452.16237 |
| SMILES | O=C(CCc1ccccc1)c1c(O)c(Cc2ccccc2O)c(O)c2c1Oc1ccccc1C2 |
| InChI | InChI=1S/C29H24O5/c30-23-12-6-4-10-19(23)16-21-27(32)22-17-20-11-5-7-13-25(20)34-29(22)26(28(21)33)24(31)15-14-18-8-2-1-3-9-18/h1-13,30,32-33H,14-17H2 |
| InChIKey | VBENIJLFKRPAAF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uvaria acuminata (ncbitaxon:672960) | root (BTO:0001188) | PubMed (14709883) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isochamuvaritin (CHEBI:66092) has role antineoplastic agent (CHEBI:35610) |
| isochamuvaritin (CHEBI:66092) has role metabolite (CHEBI:25212) |
| isochamuvaritin (CHEBI:66092) is a dihydrochalcones (CHEBI:71230) |
| isochamuvaritin (CHEBI:66092) is a polyphenol (CHEBI:26195) |
| isochamuvaritin (CHEBI:66092) is a xanthenes (CHEBI:38835) |
| IUPAC Name |
|---|
| 1-[1,3-dihydroxy-2-(2-hydroxybenzyl)-9H-xanthen-4-yl]-3-phenylpropan-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9739285 | Reaxys |
| Citations |
|---|