EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26O10 |
| Net Charge | 0 |
| Average Mass | 570.550 |
| Monoisotopic Mass | 570.15260 |
| SMILES | [H][C@@]1([C@@]2([H])C(=O)c3c(O)cc(O)cc3O[C@@]2([H])c2ccc(OC)cc2)C(=O)c2c(O)cc(O)cc2O[C@]1([H])c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H26O10/c1-39-19-7-3-15(4-8-19)31-27(29(37)25-21(35)11-17(33)13-23(25)41-31)28-30(38)26-22(36)12-18(34)14-24(26)42-32(28)16-5-9-20(40-2)10-6-16/h3-14,27-28,31-36H,1-2H3/t27-,28+,31-,32+ |
| InChIKey | BTCICADMSGBCKA-WVKQWSHJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stellera chamaejasme (ncbitaxon:142738) | root (BTO:0001188) | PubMed (15997133) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimitotic Any compound that inhibits cell division (mitosis). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isochamaejasmenin B (CHEBI:66091) has role antifungal agent (CHEBI:35718) |
| isochamaejasmenin B (CHEBI:66091) has role antimitotic (CHEBI:64911) |
| isochamaejasmenin B (CHEBI:66091) has role plant metabolite (CHEBI:76924) |
| isochamaejasmenin B (CHEBI:66091) is a 4'-methoxyflavanones (CHEBI:140332) |
| isochamaejasmenin B (CHEBI:66091) is a biflavonoid (CHEBI:50128) |
| isochamaejasmenin B (CHEBI:66091) is a hydroxyflavanone (CHEBI:24697) |
| isochamaejasmenin B (CHEBI:66091) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2R*,2'S*,3R*,3'S*)-5,5',7,7'-tetrahydroxy-2,2'-bis(4-methoxyphenyl)-2,2',3,3'-tetrahydro-4H,4'H-3,3'-bichromene-4,4'-dione |
| Synonyms | Source |
|---|---|
| rel-(2S,3S)-3-[(2R,3R)-5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one | ChEBI |
| meso- 2,2',3,3'-tetrahydro-5,5',7',7-tetrahydroxy-2,2'-bis(4-methoxyphenyl)-[3,3'-bi-4H-1-benzopyran]-4,4'-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10136566 | Reaxys |
| Citations |
|---|