EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O5 |
| Net Charge | 0 |
| Average Mass | 292.331 |
| Monoisotopic Mass | 292.13107 |
| SMILES | C=C1C(=O)O[C@H](C2=C(C)[C@@H](OC)CC2=O)[C@H]1CCC(C)=O |
| InChI | InChI=1S/C16H20O5/c1-8(17)5-6-11-9(2)16(19)21-15(11)14-10(3)13(20-4)7-12(14)18/h11,13,15H,2,5-7H2,1,3-4H3/t11-,13-,15-/m0/s1 |
| InChIKey | YMBVLYVGHGDKHO-WHOFXGATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia iwayomogi (ncbitaxon:265784) | - | PubMed (12735688) | |
| Tanacetum cilicicum (IPNI:252274-1) | - | DOI (10.1016/0031-9422(90)80039-J) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-methyl-isosecotanapartholide (CHEBI:66090) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| 3-O-methyl-isosecotanapartholide (CHEBI:66090) has role metabolite (CHEBI:25212) |
| 3-O-methyl-isosecotanapartholide (CHEBI:66090) is a butan-4-olide (CHEBI:22950) |
| 3-O-methyl-isosecotanapartholide (CHEBI:66090) is a enone (CHEBI:51689) |
| 3-O-methyl-isosecotanapartholide (CHEBI:66090) is a ether (CHEBI:25698) |
| 3-O-methyl-isosecotanapartholide (CHEBI:66090) is a methyl ketone (CHEBI:51867) |
| 3-O-methyl-isosecotanapartholide (CHEBI:66090) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (4S,5S)-5-[(3S)-3-methoxy-2-methyl-5-oxocyclopent-1-en-1-yl]-3-methylidene-4-(3-oxobutyl)dihydrofuran-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4845668 | Reaxys |
| Citations |
|---|