EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28O8 |
| Net Charge | 0 |
| Average Mass | 504.535 |
| Monoisotopic Mass | 504.17842 |
| SMILES | COc1c2c(cc3c1-c1c(cc4c(c1OC)OCO4)[C@H](OC(=O)c1ccccc1)[C@@H](C)[C@@H](C)C3)OCO2 |
| InChI | InChI=1S/C29H28O8/c1-15-10-18-11-20-25(35-13-33-20)27(31-3)22(18)23-19(12-21-26(28(23)32-4)36-14-34-21)24(16(15)2)37-29(30)17-8-6-5-7-9-17/h5-9,11-12,15-16,24H,10,13-14H2,1-4H3/t15-,16-,24+/m0/s1 |
| InChIKey | MBGKPRSARHEFAG-CCHLGUQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura interior (IPNI:554578-1) | stem (BTO:0001300) | PubMed (8946749) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| interiotherin A (CHEBI:66082) has role anti-HIV agent (CHEBI:64946) |
| interiotherin A (CHEBI:66082) has role metabolite (CHEBI:25212) |
| interiotherin A (CHEBI:66082) is a aromatic ether (CHEBI:35618) |
| interiotherin A (CHEBI:66082) is a benzoate ester (CHEBI:36054) |
| interiotherin A (CHEBI:66082) is a lignan (CHEBI:25036) |
| interiotherin A (CHEBI:66082) is a organic heteropentacyclic compound (CHEBI:38164) |
| interiotherin A (CHEBI:66082) is a oxacycle (CHEBI:38104) |
| Synonyms | Source |
|---|---|
| Cycloocta(1,2-f:3,4-f')bis(1,3)benzodioxol-5-ol, 5,6,7,8-tetrahydro-13,14-dimethoxy-6,7-dimethyl-, benzoate(5R,6S,7S,13aS) | ChemIDplus |
| (−)-interiotherin A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9303748 | Reaxys |
| CAS:181701-06-4 | ChemIDplus |
| Citations |
|---|