EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O9 |
| Net Charge | 0 |
| Average Mass | 402.355 |
| Monoisotopic Mass | 402.09508 |
| SMILES | COc1cc2c(c(O)c1O)C1(C)Oc3c(O)c(OC)cc(C=O)c3C(C)(O1)C2=O |
| InChI | InChI=1S/C20H18O9/c1-19-12-8(7-21)5-10(26-3)15(23)17(12)28-20(2,29-19)13-9(18(19)25)6-11(27-4)14(22)16(13)24/h5-7,22-24H,1-4H3 |
| InChIKey | PECRJLBPKXQZDC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascochyta (ncbitaxon:5453) | - | DOI (10.1016/S0040-4039(02)00265-4) | Organism is an endophyte isolated from the leaves of Urtica urens Strain: ATCC 74477 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| integrastatin B (CHEBI:66080) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| integrastatin B (CHEBI:66080) has role metabolite (CHEBI:25212) |
| integrastatin B (CHEBI:66080) is a aldehyde (CHEBI:17478) |
| integrastatin B (CHEBI:66080) is a aromatic ether (CHEBI:35618) |
| integrastatin B (CHEBI:66080) is a bridged compound (CHEBI:35990) |
| integrastatin B (CHEBI:66080) is a cyclic ether (CHEBI:37407) |
| integrastatin B (CHEBI:66080) is a cyclic ketone (CHEBI:3992) |
| integrastatin B (CHEBI:66080) is a organic heterotetracyclic compound (CHEBI:38163) |
| integrastatin B (CHEBI:66080) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4,7,8-trihydroxy-3,9-dimethoxy-6,12-dimethyl-11-oxo-11,12-dihydro-6H-6,12-epoxydibenzo[b,f]oxocine-1-carbaldehyde |
| Synonym | Source |
|---|---|
| rac-4,7,8-trihydroxy-3,9-dimethoxy-6,12-dimethyl-11-oxo-11,12-dihydro-6H-6,12-epoxydibenzo[b,f]oxocine-1-carbaldehyde | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9163563 | Reaxys |
| CAS:324518-09-4 | ChemIDplus |