EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O9 |
| Net Charge | 0 |
| Average Mass | 402.355 |
| Monoisotopic Mass | 402.09508 |
| SMILES | COc1cc2c(c(O)c1O)C1(C)Oc3c(O)c(OC)cc(C=O)c3C(C)(O1)C2=O |
| InChI | InChI=1S/C20H18O9/c1-19-12-8(7-21)5-10(26-3)15(23)17(12)28-20(2,29-19)13-9(18(19)25)6-11(27-4)14(22)16(13)24/h5-7,22-24H,1-4H3 |
| InChIKey | PECRJLBPKXQZDC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascochyta (ncbitaxon:5453) | - | DOI (10.1016/S0040-4039(02)00265-4) | Organism is an endophyte isolated from the leaves of Urtica urens Strain: ATCC 74477 |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| integrastatin B (CHEBI:66080) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| integrastatin B (CHEBI:66080) has role metabolite (CHEBI:25212) |
| integrastatin B (CHEBI:66080) is a aldehyde (CHEBI:17478) |
| integrastatin B (CHEBI:66080) is a aromatic ether (CHEBI:35618) |
| integrastatin B (CHEBI:66080) is a bridged compound (CHEBI:35990) |
| integrastatin B (CHEBI:66080) is a cyclic ether (CHEBI:37407) |
| integrastatin B (CHEBI:66080) is a cyclic ketone (CHEBI:3992) |
| integrastatin B (CHEBI:66080) is a organic heterotetracyclic compound (CHEBI:38163) |
| integrastatin B (CHEBI:66080) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4,7,8-trihydroxy-3,9-dimethoxy-6,12-dimethyl-11-oxo-11,12-dihydro-6H-6,12-epoxydibenzo[b,f]oxocine-1-carbaldehyde |
| Synonym | Source |
|---|---|
| rac-4,7,8-trihydroxy-3,9-dimethoxy-6,12-dimethyl-11-oxo-11,12-dihydro-6H-6,12-epoxydibenzo[b,f]oxocine-1-carbaldehyde | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9163563 | Reaxys |
| CAS:324518-09-4 | ChemIDplus |