EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H54O7 |
| Net Charge | 0 |
| Average Mass | 586.810 |
| Monoisotopic Mass | 586.38695 |
| SMILES | CCC[C@@H](O)CCCCCCCc1cc(O)cc(O)c1C(=O)O[C@H](CCC)CCCCCCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C35H54O7/c1-3-15-28(36)19-13-9-6-8-12-18-27-23-31(39)25-33(40)34(27)35(41)42-32(16-4-2)20-14-10-5-7-11-17-26-21-29(37)24-30(38)22-26/h21-25,28,32,36-40H,3-20H2,1-2H3/t28-,32-/m1/s1 |
| InChIKey | IKNYNBVDLOWJFN-AKGWNBJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytonaema (mycobank:7899) | |||
| - | DOI (10.1016/S0040-4039(02)00083-7) | Strain: MF 6253 | |
| - | DOI (10.1016/S0040-4039(02)00083-7) | Strain: ATCC 74413 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| integracin B (CHEBI:66077) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| integracin B (CHEBI:66077) has role metabolite (CHEBI:25212) |
| integracin B (CHEBI:66077) is a benzoate ester (CHEBI:36054) |
| integracin B (CHEBI:66077) is a resorcinols (CHEBI:33572) |
| integracin B (CHEBI:66077) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (4R)-11-(3,5-dihydroxyphenyl)undecan-4-yl 2,4-dihydroxy-6-[(8R)-8-hydroxyundecyl]benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22818305 | Reaxys |
| Citations |
|---|