EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O7 |
| Net Charge | 0 |
| Average Mass | 432.513 |
| Monoisotopic Mass | 432.21480 |
| SMILES | [H][C@@]12C[C@H](OC(C)=O)[C@]3([H])[C@@](CC(=O)[C@]4([H])C(C)(C)[C@@H](OC(C)=O)C[C@H](O)[C@@]34C)(C1)C(=O)C2=C |
| InChI | InChI=1S/C24H32O7/c1-11-14-7-16(30-12(2)25)20-23(6)17(28)8-18(31-13(3)26)22(4,5)19(23)15(27)10-24(20,9-14)21(11)29/h14,16-20,28H,1,7-10H2,2-6H3/t14-,16+,17+,18+,19-,20+,23-,24+/m1/s1 |
| InChIKey | LSJBRRZMOVGSIZ-XRBPMINJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rabdosia inflexa (IPNI:455379-1) | leaf (BTO:0000713) | DOI (10.1016/0031-9422(82)80090-3) | |
| Isodon excisus (ncbitaxon:705303) | whole plant (BTO:0001461) | PubMed (10896056) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inflexin (CHEBI:66075) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| inflexin (CHEBI:66075) has role metabolite (CHEBI:25212) |
| inflexin (CHEBI:66075) is a ent-kaurane diterpenoid (CHEBI:36760) |
| inflexin (CHEBI:66075) is a acetate ester (CHEBI:47622) |
| inflexin (CHEBI:66075) is a bridged compound (CHEBI:35990) |
| inflexin (CHEBI:66075) is a cyclic ketone (CHEBI:3992) |
| inflexin (CHEBI:66075) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1α,3β,5β,8α,9β,10α,11β,13α)-1-hydroxy-6,15-dioxokaur-16-ene-3,11-diyl diacetate |
| Synonym | Source |
|---|---|
| ent-1α-hydroxy-3β,6a-diacetoxykaur-16-en-11,15-dione | ChEBI |
| Citations |
|---|