EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O9 |
| Net Charge | 0 |
| Average Mass | 372.370 |
| Monoisotopic Mass | 372.14203 |
| SMILES | CCCCC(=O)c1c(O)cc(O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O9/c1-2-3-4-9(20)13-10(21)5-8(19)6-11(13)25-17-16(24)15(23)14(22)12(7-18)26-17/h5-6,12,14-19,21-24H,2-4,7H2,1H3/t12-,14-,15+,16-,17-/m1/s1 |
| InChIKey | ZVEZLHVYHCHUEI-USACIQFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Indigofera heterantha (ncbitaxon:198880) | whole plant (BTO:0001461) | PubMed (15744094) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(pentanoyl)-phloroglucinyl]-β-D-glucopyranoside (CHEBI:66074) has functional parent phloroglucinol (CHEBI:16204) |
| 1-[(pentanoyl)-phloroglucinyl]-β-D-glucopyranoside (CHEBI:66074) has role lipoxygenase inhibitor (CHEBI:35856) |
| 1-[(pentanoyl)-phloroglucinyl]-β-D-glucopyranoside (CHEBI:66074) has role metabolite (CHEBI:25212) |
| 1-[(pentanoyl)-phloroglucinyl]-β-D-glucopyranoside (CHEBI:66074) is a aromatic ketone (CHEBI:76224) |
| 1-[(pentanoyl)-phloroglucinyl]-β-D-glucopyranoside (CHEBI:66074) is a catechols (CHEBI:33566) |
| 1-[(pentanoyl)-phloroglucinyl]-β-D-glucopyranoside (CHEBI:66074) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-pentanoylphenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10122424 | Reaxys |
| Citations |
|---|