EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O9 |
| Net Charge | 0 |
| Average Mass | 372.370 |
| Monoisotopic Mass | 372.14203 |
| SMILES | CC(C)CC(=O)c1c(O)cc(O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O9/c1-7(2)3-9(20)13-10(21)4-8(19)5-11(13)25-17-16(24)15(23)14(22)12(6-18)26-17/h4-5,7,12,14-19,21-24H,3,6H2,1-2H3/t12-,14-,15+,16-,17-/m1/s1 |
| InChIKey | SYVLRDXITUYNAK-USACIQFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Indigofera heterantha (ncbitaxon:198880) | whole plant (BTO:0001461) | PubMed (15744094) |
| Roles Classification |
|---|
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(3-methylbutanoyl)phloroglucinyl]-β-D-glucopyranoside (CHEBI:66073) has functional parent phloroglucinol (CHEBI:16204) |
| 1-[(3-methylbutanoyl)phloroglucinyl]-β-D-glucopyranoside (CHEBI:66073) has role lipoxygenase inhibitor (CHEBI:35856) |
| 1-[(3-methylbutanoyl)phloroglucinyl]-β-D-glucopyranoside (CHEBI:66073) has role metabolite (CHEBI:25212) |
| 1-[(3-methylbutanoyl)phloroglucinyl]-β-D-glucopyranoside (CHEBI:66073) is a aromatic ketone (CHEBI:76224) |
| 1-[(3-methylbutanoyl)phloroglucinyl]-β-D-glucopyranoside (CHEBI:66073) is a polyphenol (CHEBI:26195) |
| 1-[(3-methylbutanoyl)phloroglucinyl]-β-D-glucopyranoside (CHEBI:66073) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(3-methylbutanoyl)phenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2-β-D-glucopyranosyloxy-4,6-dihydroxyisovalerophenone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9660393 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10035977 | Reaxys |
| Citations |
|---|