EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | C=C(C)[C@@H]1CCC(CO)=C2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C15H20O2/c1-9(2)11-4-5-12(8-16)14-7-15(17)10(3)13(14)6-11/h11,16H,1,4-8H2,2-3H3/t11-/m1/s1 |
| InChIKey | BIWBNAFBKLFTGT-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Wikstroemia indica (ncbitaxon:714517) | root (BTO:0001188) | PubMed (15635251) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indicanone (CHEBI:66072) has role anti-inflammatory agent (CHEBI:67079) |
| indicanone (CHEBI:66072) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| indicanone (CHEBI:66072) has role metabolite (CHEBI:25212) |
| indicanone (CHEBI:66072) is a guaiane sesquiterpenoid (CHEBI:36744) |
| indicanone (CHEBI:66072) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (5R)-8-(hydroxymethyl)-3-methyl-5-(prop-1-en-2-yl)-4,5,6,7-tetrahydroazulen-2(1H)-one |
| Synonym | Source |
|---|---|
| (+)-indicanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22726878 | Reaxys |
| Citations |
|---|