EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | CC(C)=CCOc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C16H14O4/c1-10(2)5-7-19-16-11-3-4-15(17)20-14(11)9-13-12(16)6-8-18-13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | IGWDEVSBEKYORK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica dahurica (ncbitaxon:48101) | root (BTO:0001188) | PubMed (12510838) | |
| Angelica koreana (ncbitaxon:182415) | root (BTO:0001188) | PubMed (17396918) | |
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoimperatorin (CHEBI:66071) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| isoimperatorin (CHEBI:66071) has role metabolite (CHEBI:25212) |
| isoimperatorin (CHEBI:66071) is a psoralens (CHEBI:26369) |
| IUPAC Name |
|---|
| 4-[(3-methylbut-2-en-1-yl)oxy]-7H-furo[3,2-g]chromen-7-one |
| Synonym | Source |
|---|---|
| 7,4-[(3-methyl-2-butenyl)oxy]-7H-furo[3,2-g]-1-benzopyran-7-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16976 | KEGG COMPOUND |
| CN102188464 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1291723 | Reaxys |
| CAS:482-45-1 | KEGG COMPOUND |
| CAS:482-45-1 | ChemIDplus |
| Citations |
|---|