EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | CC(C)=CCOc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C16H14O4/c1-10(2)5-7-19-16-11-3-4-15(17)20-14(11)9-13-12(16)6-8-18-13/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | IGWDEVSBEKYORK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica koreana (ncbitaxon:182415) | root (BTO:0001188) | PubMed (17396918) | |
| Angelica dahurica (ncbitaxon:48101) | root (BTO:0001188) | PubMed (12510838) | |
| Peucedanum ostruthium (ncbitaxon:1000424) | |||
| rhizome (BTO:0001181) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| root (BTO:0001188) | PubMed (21627108) | Dichloromethane extract of dried, powdered roots and rhizomes | |
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoimperatorin (CHEBI:66071) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| isoimperatorin (CHEBI:66071) has role metabolite (CHEBI:25212) |
| isoimperatorin (CHEBI:66071) is a psoralens (CHEBI:26369) |
| IUPAC Name |
|---|
| 4-[(3-methylbut-2-en-1-yl)oxy]-7H-furo[3,2-g]chromen-7-one |
| Synonym | Source |
|---|---|
| 7,4-[(3-methyl-2-butenyl)oxy]-7H-furo[3,2-g]-1-benzopyran-7-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16976 | KEGG COMPOUND |
| CN102188464 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1291723 | Reaxys |
| CAS:482-45-1 | ChemIDplus |
| CAS:482-45-1 | KEGG COMPOUND |
| Citations |
|---|