EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O2 |
| Net Charge | 0 |
| Average Mass | 232.323 |
| Monoisotopic Mass | 232.14633 |
| SMILES | [H][C@@]12C[C@](C)(C=C)[C@@H](C(=C)C)C[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C15H20O2/c1-6-15(5)8-13-11(7-12(15)9(2)3)10(4)14(16)17-13/h6,11-13H,1-2,4,7-8H2,3,5H3/t11-,12-,13-,15+/m1/s1 |
| InChIKey | IFASGTOWHLMHEZ-BHPKHCPMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Liatris platylepis (IPNI:230618-1) | - | DOI (10.1016/0031-9422(79)80145-4) | |
| Rudbeckia laciniata (ncbitaxon:52310) | root (BTO:0001188) | DOI (10.1016/S0031-9422(98)00251-9) | |
| Inula helenium (ncbitaxon:55635) | root (BTO:0001188) | PubMed (12392098) | |
| Eupatorium quadrangulare (IPNI:100785-2) | - | DOI (10.1016/S0031-9422(00)81100-0) | |
| Inula grandis Schrenk (IPNI:225901-1) | root (BTO:0001188) | Article (KHIM PRIR SOEDIN, 1970, 6, 508) | |
| Critonia quadrangularis (IPNI:69565-2) | - | DOI (10.1016/S0031-9422(00)81431-4) | |
| Stevia polyphylla (IPNI:251515-1) | - | DOI (10.1016/0031-9422(88)80673-3) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| igalan (CHEBI:66068) has role antineoplastic agent (CHEBI:35610) |
| igalan (CHEBI:66068) has role metabolite (CHEBI:25212) |
| igalan (CHEBI:66068) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3aR,5R,6R,7aR)-6-methyl-3-methylene-5-(prop-1-en-2-yl)-6-vinylhexahydro-1-benzofuran-2(3H)-one |
| Synonym | Source |
|---|---|
| 1,3,11(13)-elematriene-8β,12-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5267066 | Reaxys |
| Citations |
|---|