EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H47NO20 |
| Net Charge | 0 |
| Average Mass | 873.814 |
| Monoisotopic Mass | 873.26914 |
| SMILES | [H][C@@]12[C@@H](OC(C)=O)[C@@]34O[C@@]1(C)COC(=O)c1cnccc1C(C)C(C)(O)C(=O)O[C@@]([H])([C@H](OC(=O)c1ccco1)[C@H](OC(C)=O)[C@@]3(COC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@]4(C)O |
| InChI | InChI=1S/C41H47NO20/c1-18-24-12-13-42-15-25(24)34(48)55-16-37(7)27-28(56-20(3)44)32(58-22(5)46)40(17-54-19(2)43)33(59-23(6)47)29(60-35(49)26-11-10-14-53-26)31(61-36(50)38(18,8)51)39(9,52)41(40,62-37)30(27)57-21(4)45/h10-15,18,27-33,51-52H,16-17H2,1-9H3/t18?,27-,28-,29+,30-,31+,32-,33+,37+,38?,39+,40-,41+/m1/s1 |
| InChIKey | JXQXTWWCCNHEQZ-PEWXIWONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium hypoglaucum (ncbitaxon:205465) | root (BTO:0001188) | DOI (10.1016/S0040-4039(99)00339-1) | Previous component: root bark; |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypoglaunine B (CHEBI:66060) has role anti-HIV agent (CHEBI:64946) |
| hypoglaunine B (CHEBI:66060) has role plant metabolite (CHEBI:76924) |
| hypoglaunine B (CHEBI:66060) is a 2-furoate ester (CHEBI:50856) |
| hypoglaunine B (CHEBI:66060) is a acetate ester (CHEBI:47622) |
| hypoglaunine B (CHEBI:66060) is a dihydroagarofuran sesquiterpenoid (CHEBI:71548) |
| hypoglaunine B (CHEBI:66060) is a macrolide (CHEBI:25106) |
| hypoglaunine B (CHEBI:66060) is a pyridine alkaloid (CHEBI:26416) |
| hypoglaunine B (CHEBI:66060) is a sesquiterpene alkaloid (CHEBI:26657) |
| Synonym | Source |
|---|---|
| 1,5,7,8,11-pentaacetoxy-2-furanoyl-4-hydroxy-3,15[2'-hydroxy-2',3'-dimethyl-3'-(3''-carboxy-4''-pyridyl)-propanoic acid]dicarbolactone-dihydroagarofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8105725 | Reaxys |
| Citations |
|---|