EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | COC1=CC(=O)c2c(O)c(OC)c3c(c2C1=O)-c1c2c(c(O)c(OC)c1[C@@H](C(C)=O)[C@@](C)(O)C3)C(=O)C=C(OC)C2=O |
| InChI | InChI=1S/C30H26O12/c1-10(31)23-22-19(21-18(27(37)29(22)42-6)13(33)8-15(40-4)25(21)35)16-11(9-30(23,2)38)28(41-5)26(36)17-12(32)7-14(39-3)24(34)20(16)17/h7-8,23,36-38H,9H2,1-6H3/t23-,30+/m1/s1 |
| InChIKey | UVHNWRDTZAYVST-DJUQAAIZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Shiraia bambusicola (ncbitaxon:224420) | fruit body (BTO:0000487) | PubMed (16915819) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypocrellin D (CHEBI:66059) has role antineoplastic agent (CHEBI:35610) |
| hypocrellin D (CHEBI:66059) has role metabolite (CHEBI:25212) |
| hypocrellin D (CHEBI:66059) is a aromatic ether (CHEBI:35618) |
| hypocrellin D (CHEBI:66059) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| hypocrellin D (CHEBI:66059) is a methyl ketone (CHEBI:51867) |
| hypocrellin D (CHEBI:66059) is a organic polycyclic compound (CHEBI:51958) |
| hypocrellin D (CHEBI:66059) is a polyphenol (CHEBI:26195) |
| hypocrellin D (CHEBI:66059) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3R,4S)-3-acetyl-1,4,7-trihydroxy-2,6,10,13-tetramethoxy-4-methyl-4,5-dihydro-3H-cyclohepta[1,2-a:7,6-a']dinaphthalene-8,11,12,15-tetrone |
| Citations |
|---|