EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O6 |
| Net Charge | 0 |
| Average Mass | 328.320 |
| Monoisotopic Mass | 328.09469 |
| SMILES | CC1(C)CCc2c(c(O)cc3oc4cc(O)cc(O)c4c(=O)c23)O1 |
| InChI | InChI=1S/C18H16O6/c1-18(2)4-3-9-14-13(7-11(21)17(9)24-18)23-12-6-8(19)5-10(20)15(12)16(14)22/h5-7,19-21H,3-4H2,1-2H3 |
| InChIKey | JXBWMJZDYVJVIV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum scabrum (IPNI:433837-1) | - | PubMed (15568778) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperxanthone E (CHEBI:66058) has role antineoplastic agent (CHEBI:35610) |
| hyperxanthone E (CHEBI:66058) has role metabolite (CHEBI:25212) |
| hyperxanthone E (CHEBI:66058) is a cyclic ketone (CHEBI:3992) |
| hyperxanthone E (CHEBI:66058) is a polyphenol (CHEBI:26195) |
| hyperxanthone E (CHEBI:66058) is a pyranoxanthene (CHEBI:64515) |
| IUPAC Name |
|---|
| 5,9,11-trihydroxy-3,3-dimethyl-2,3-dihydropyrano[3,2-a]xanthen-12(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1355152 | Reaxys |
| Citations |
|---|