EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | C=C(C)C(O)Cc1c(O)c(O)cc2oc3cc(O)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C18H16O7/c1-7(2)10(20)5-9-15-14(6-12(22)17(9)23)25-13-4-8(19)3-11(21)16(13)18(15)24/h3-4,6,10,19-23H,1,5H2,2H3 |
| InChIKey | GONMHOQVFDWXLV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum scabrum (IPNI:433837-1) | - | PubMed (15568778) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperxanthone C (CHEBI:66057) has role antineoplastic agent (CHEBI:35610) |
| hyperxanthone C (CHEBI:66057) has role metabolite (CHEBI:25212) |
| hyperxanthone C (CHEBI:66057) is a polyphenol (CHEBI:26195) |
| hyperxanthone C (CHEBI:66057) is a secondary alcohol (CHEBI:35681) |
| hyperxanthone C (CHEBI:66057) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 2,3,6,8-tetrahydroxy-1-(2-hydroxy-3-methylbut-3-en-1-yl)-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11309674 | Reaxys |
| Citations |
|---|