EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC[C@@]34OC(=O)[C@]5(CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C)[C@@H](O)CC(=C)[C@@H](C)[C@@]45[H] |
| InChI | InChI=1S/C30H46O4/c1-17-16-22(32)29-15-14-28(7)27(6)12-8-19-25(3,4)21(31)10-11-26(19,5)20(27)9-13-30(28,34-24(29)33)23(29)18(17)2/h18-23,31-32H,1,8-16H2,2-7H3/t18-,19+,20-,21+,22+,23-,26+,27-,28+,29-,30+/m1/s1 |
| InChIKey | QYROTRGSZYKHDK-WVDNJEOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum oblongifolium (ncbitaxon:673930) | whole plant (BTO:0001461) | PubMed (16880649) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperinol B (CHEBI:66055) has parent hydride taraxastane (CHEBI:72618) |
| hyperinol B (CHEBI:66055) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| hyperinol B (CHEBI:66055) has role metabolite (CHEBI:25212) |
| hyperinol B (CHEBI:66055) is a bridged compound (CHEBI:35990) |
| hyperinol B (CHEBI:66055) is a diol (CHEBI:23824) |
| hyperinol B (CHEBI:66055) is a hexacyclic triterpenoid (CHEBI:70994) |
| hyperinol B (CHEBI:66055) is a secondary alcohol (CHEBI:35681) |
| hyperinol B (CHEBI:66055) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3β,19α,22α)-3,22-dihydroxy-13,28-epoxyurs-20(30)-en-28-one |
| Synonym | Source |
|---|---|
| 3β,22α-dihydroxy-20(30)-taraxastene-28,13beta-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10504503 | Reaxys |
| Citations |
|---|