EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12CC[C@@]34OC(=O)[C@]5(CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C)[C@@H](O)CC(=C)[C@@H](C)[C@@]45[H] |
| InChI | InChI=1S/C30H46O4/c1-17-16-22(32)29-15-14-28(7)27(6)12-8-19-25(3,4)21(31)10-11-26(19,5)20(27)9-13-30(28,34-24(29)33)23(29)18(17)2/h18-23,31-32H,1,8-16H2,2-7H3/t18-,19+,20-,21+,22+,23-,26+,27-,28+,29-,30+/m1/s1 |
| InChIKey | QYROTRGSZYKHDK-WVDNJEOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum oblongifolium (ncbitaxon:673930) | whole plant (BTO:0001461) | PubMed (16880649) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperinol B (CHEBI:66055) has parent hydride taraxastane (CHEBI:72618) |
| hyperinol B (CHEBI:66055) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| hyperinol B (CHEBI:66055) has role metabolite (CHEBI:25212) |
| hyperinol B (CHEBI:66055) is a bridged compound (CHEBI:35990) |
| hyperinol B (CHEBI:66055) is a diol (CHEBI:23824) |
| hyperinol B (CHEBI:66055) is a hexacyclic triterpenoid (CHEBI:70994) |
| hyperinol B (CHEBI:66055) is a secondary alcohol (CHEBI:35681) |
| hyperinol B (CHEBI:66055) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3β,19α,22α)-3,22-dihydroxy-13,28-epoxyurs-20(30)-en-28-one |
| Synonym | Source |
|---|---|
| 3β,22α-dihydroxy-20(30)-taraxastene-28,13beta-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10504503 | Reaxys |
| Citations |
|---|