EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O3 |
| Net Charge | 0 |
| Average Mass | 144.170 |
| Monoisotopic Mass | 144.07864 |
| SMILES | [H][C@@]1([C@@H](C)O)C(=O)OC[C@H]1C |
| InChI | InChI=1S/C7H12O3/c1-4-3-10-7(9)6(4)5(2)8/h4-6,8H,3H2,1-2H3/t4-,5-,6-/m1/s1 |
| InChIKey | POKADFGKQLIDGO-HSUXUTPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoleptodonoides aitchisonii (ncbitaxon:1076280) | - | DOI (10.1016/j.tet.2008.10.068) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4S,1'R)-3-(1'-hydroxyethyl)-4-methyldihydrofuran-2(3H)-one (CHEBI:66043) has role metabolite (CHEBI:25212) |
| (3R,4S,1'R)-3-(1'-hydroxyethyl)-4-methyldihydrofuran-2(3H)-one (CHEBI:66043) has role neuroprotective agent (CHEBI:63726) |
| (3R,4S,1'R)-3-(1'-hydroxyethyl)-4-methyldihydrofuran-2(3H)-one (CHEBI:66043) is a secondary alcohol (CHEBI:35681) |
| (3R,4S,1'R)-3-(1'-hydroxyethyl)-4-methyldihydrofuran-2(3H)-one (CHEBI:66043) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3R,4S)-3-[(1R)-1-hydroxyethyl]-4-methyldihydrofuran-2(3H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18852552 | Reaxys |