EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H22O13 |
| Net Charge | 0 |
| Average Mass | 614.515 |
| Monoisotopic Mass | 614.10604 |
| SMILES | [H][C@@]12OC(=O)C[C@]1([H])O[C@@H](C)C1=C2C(=O)c2c(O)cc(-c3cc(O)c4c(c3)C(=O)C3=C(C4=O)[C@]4([H])OC(=O)C[C@]4([H])O[C@]3(C)O)cc2C1=O |
| InChI | InChI=1S/C32H22O13/c1-9-20-23(30-16(42-9)7-18(35)43-30)28(39)21-12(26(20)37)3-10(5-14(21)33)11-4-13-22(15(34)6-11)29(40)24-25(27(13)38)32(2,41)45-17-8-19(36)44-31(17)24/h3-6,9,16-17,30-31,33-34,41H,7-8H2,1-2H3/t9-,16-,17-,30+,31+,32-/m0/s1 |
| InChIKey | RGOCVNGEBMGCNA-WIDQCZIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora (ncbitaxon:1873) | - | PubMed (9531992) | Strain: SA 246 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxycrisamicin A (CHEBI:66042) has role antibacterial agent (CHEBI:33282) |
| 1-hydroxycrisamicin A (CHEBI:66042) has role metabolite (CHEBI:25212) |
| 1-hydroxycrisamicin A (CHEBI:66042) is a p-quinones (CHEBI:25830) |
| 1-hydroxycrisamicin A (CHEBI:66042) is a cyclic ether (CHEBI:37407) |
| 1-hydroxycrisamicin A (CHEBI:66042) is a organic heterotetracyclic compound (CHEBI:38163) |
| 1-hydroxycrisamicin A (CHEBI:66042) is a organic hydroxy compound (CHEBI:33822) |
| 1-hydroxycrisamicin A (CHEBI:66042) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,3a'S,5S,5'S,11bS,11b'S)-5,10,10'-trihydroxy-5,5'-dimethyl-3,3',3a,3a',5,5',11b,11b'-octahydro-2H,2'H-8,8'-bibenzo[g]furo[3,2-c]isochromene-2,2',6,6',11,11'-hexone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8180397 | Reaxys |
| Citations |
|---|