EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O7 |
| Net Charge | 0 |
| Average Mass | 358.346 |
| Monoisotopic Mass | 358.10525 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3cc(OC)c(OC)cc3OC)oc2c1 |
| InChI | InChI=1S/C19H18O7/c1-22-10-5-12(20)19-13(21)8-15(26-18(19)6-10)11-7-16(24-3)17(25-4)9-14(11)23-2/h5-9,20H,1-4H3 |
| InChIKey | JZIWGWPCBNNLJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calliandra californica (ncbitaxon:247896) | root (BTO:0001188) | PubMed (7798967) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-7,2',4',5'-tetramethoxyflavone (CHEBI:66040) has role antibacterial agent (CHEBI:33282) |
| 5-hydroxy-7,2',4',5'-tetramethoxyflavone (CHEBI:66040) has role metabolite (CHEBI:25212) |
| 5-hydroxy-7,2',4',5'-tetramethoxyflavone (CHEBI:66040) is a monohydroxyflavone (CHEBI:38687) |
| 5-hydroxy-7,2',4',5'-tetramethoxyflavone (CHEBI:66040) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 5-hydroxy-7-methoxy-2-(2,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 5-hydroxy-7-methoxy-2-(2,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7313462 | Reaxys |
| Citations |
|---|