EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H38O3 |
| Net Charge | 0 |
| Average Mass | 374.565 |
| Monoisotopic Mass | 374.28210 |
| SMILES | CCCCC/C=C\C=C\C(O)C/C=C\C/C=C\C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C24H38O3/c1-2-3-4-5-11-14-17-20-23(25)21-18-15-12-9-7-6-8-10-13-16-19-22-24(26)27/h7-11,14-15,17-18,20,23,25H,2-6,12-13,16,19,21-22H2,1H3,(H,26,27)/b9-7-,10-8-,14-11-,18-15-,20-17+ |
| InChIKey | WCPFNHAOKQUJEV-YQUHDJBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinularia numerosa (ncbitaxon:668470) | - | PubMed (19036594) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-hydroxy-tetracosa-6,9,12,16,18-pentaenoic acid (CHEBI:66039) has role angiogenesis modulating agent (CHEBI:50926) |
| 15-hydroxy-tetracosa-6,9,12,16,18-pentaenoic acid (CHEBI:66039) has role metabolite (CHEBI:25212) |
| 15-hydroxy-tetracosa-6,9,12,16,18-pentaenoic acid (CHEBI:66039) is a long-chain fatty acid (CHEBI:15904) |
| 15-hydroxy-tetracosa-6,9,12,16,18-pentaenoic acid (CHEBI:66039) is a oxylipin (CHEBI:61121) |
| 15-hydroxy-tetracosa-6,9,12,16,18-pentaenoic acid (CHEBI:66039) is a polyunsaturated fatty acid (CHEBI:26208) |
| 15-hydroxy-tetracosa-6,9,12,16,18-pentaenoic acid (CHEBI:66039) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (6Z,9Z,12Z,16E,18Z)-15-hydroxytetracosa-6,9,12,16,18-pentaenoic acid |
| Synonym | Source |
|---|---|
| 15-HTPE | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19306313 | Reaxys |
| Citations |
|---|