EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O3 |
| Net Charge | 0 |
| Average Mass | 308.462 |
| Monoisotopic Mass | 308.23514 |
| SMILES | CC/C=C\C/C=C\C=C\C(O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O3/c1-3-4-5-6-7-9-12-15-18(20)16-13-10-8-11-14-17-19(21)22-2/h4-5,7,9,12,15,18,20H,3,6,8,10-11,13-14,16-17H2,1-2H3/b5-4-,9-7-,15-12+ |
| InChIKey | MTOOOXVLHAITCG-RUDXKNGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ehretia dicksonii (IPNI:116012-1) | |||
| twig (BTO:0001411) | PubMed (10830513) | ||
| leaf (BTO:0000713) | PubMed (10830513) |
| Roles Classification |
|---|
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) has role anti-inflammatory agent (CHEBI:67079) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) has role lipoxygenase inhibitor (CHEBI:35856) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) has role metabolite (CHEBI:25212) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl (10E,12Z,15Z)-9-hydroxyoctadeca-10,12,15-trienoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2335185 | Reaxys |
| Citations |
|---|