EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O3 |
| Net Charge | 0 |
| Average Mass | 308.462 |
| Monoisotopic Mass | 308.23514 |
| SMILES | CC/C=C\C/C=C\C=C\C(O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O3/c1-3-4-5-6-7-9-12-15-18(20)16-13-10-8-11-14-17-19(21)22-2/h4-5,7,9,12,15,18,20H,3,6,8,10-11,13-14,16-17H2,1-2H3/b5-4-,9-7-,15-12+ |
| InChIKey | MTOOOXVLHAITCG-RUDXKNGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ehretia dicksonii (IPNI:116012-1) | |||
| twig (BTO:0001411) | PubMed (10830513) | ||
| leaf (BTO:0000713) | PubMed (10830513) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) has role anti-inflammatory agent (CHEBI:67079) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) has role lipoxygenase inhibitor (CHEBI:35856) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) has role metabolite (CHEBI:25212) |
| (10E,12Z,15Z)-9-hydroxy-10,12,15-octadecatrienoic acid methyl ester (CHEBI:66038) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl (10E,12Z,15Z)-9-hydroxyoctadeca-10,12,15-trienoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2335185 | Reaxys |
| Citations |
|---|