EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O2 |
| Net Charge | 0 |
| Average Mass | 178.231 |
| Monoisotopic Mass | 178.09938 |
| SMILES | O=C(CCO)CCc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c12-9-8-11(13)7-6-10-4-2-1-3-5-10/h1-5,12H,6-9H2 |
| InChIKey | VQTZONPDOFOTIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoleptodonoides aitchisonii (ncbitaxon:1076280) | - | DOI (10.1016/j.tet.2008.10.068) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxy-5-phenyl-3-pentanone (CHEBI:66037) has role metabolite (CHEBI:25212) |
| 1-hydroxy-5-phenyl-3-pentanone (CHEBI:66037) has role neuroprotective agent (CHEBI:63726) |
| 1-hydroxy-5-phenyl-3-pentanone (CHEBI:66037) is a primary alcohol (CHEBI:15734) |
| 1-hydroxy-5-phenyl-3-pentanone (CHEBI:66037) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| 1-hydroxy-5-phenylpentan-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7805954 | Reaxys |