EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O7 |
| Net Charge | 0 |
| Average Mass | 376.405 |
| Monoisotopic Mass | 376.15220 |
| SMILES | COc1ccc2c(c1OC)O[C@H](c1cc(OC)c(OC)c(OC)c1O)CC2 |
| InChI | InChI=1S/C20H24O7/c1-22-14-9-7-11-6-8-13(27-17(11)18(14)24-3)12-10-15(23-2)19(25-4)20(26-5)16(12)21/h7,9-10,13,21H,6,8H2,1-5H3/t13-/m0/s1 |
| InChIKey | WULREJCBPYVGCY-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Muntingia calabura (ncbitaxon:45164) | root (BTO:0001188) | PubMed (2045815) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2'-hydroxy-7,8,3',4',5'-pentamethoxyflavan (CHEBI:66036) has parent hydride (2S)-flavan (CHEBI:36103) |
| (2S)-2'-hydroxy-7,8,3',4',5'-pentamethoxyflavan (CHEBI:66036) has role antineoplastic agent (CHEBI:35610) |
| (2S)-2'-hydroxy-7,8,3',4',5'-pentamethoxyflavan (CHEBI:66036) has role plant metabolite (CHEBI:76924) |
| (2S)-2'-hydroxy-7,8,3',4',5'-pentamethoxyflavan (CHEBI:66036) is a hydroxyflavan (CHEBI:72010) |
| (2S)-2'-hydroxy-7,8,3',4',5'-pentamethoxyflavan (CHEBI:66036) is a methoxyflavan (CHEBI:72585) |
| IUPAC Name |
|---|
| 6-[(2S)-7,8-dimethoxy-3,4-dihydro-2H-chromen-2-yl]-2,3,4-trimethoxyphenol |
| Citations |
|---|