EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4 |
| Net Charge | 0 |
| Average Mass | 228.288 |
| Monoisotopic Mass | 228.13616 |
| SMILES | CC(=O)OC(C)(C)[C@@H]1C=C[C@](C)(OO)CC1 |
| InChI | InChI=1S/C12H20O4/c1-9(13)15-11(2,3)10-5-7-12(4,16-14)8-6-10/h5,7,10,14H,6,8H2,1-4H3/t10-,12+/m1/s1 |
| InChIKey | VIUQTXYGNHOJBD-PWSUYJOCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurus nobilis (ncbitaxon:85223) | leaf (BTO:0000713) | PubMed (12419922) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,4S)-1-hydroperoxy-p-menth-2-en-8-ol acetate (CHEBI:66035) has role metabolite (CHEBI:25212) |
| (1R,4S)-1-hydroperoxy-p-menth-2-en-8-ol acetate (CHEBI:66035) has role trypanocidal drug (CHEBI:36335) |
| (1R,4S)-1-hydroperoxy-p-menth-2-en-8-ol acetate (CHEBI:66035) is a p-menthane monoterpenoid (CHEBI:25186) |
| (1R,4S)-1-hydroperoxy-p-menth-2-en-8-ol acetate (CHEBI:66035) is a acetate ester (CHEBI:47622) |
| (1R,4S)-1-hydroperoxy-p-menth-2-en-8-ol acetate (CHEBI:66035) is a peroxol (CHEBI:35924) |
| IUPAC Name |
|---|
| 2-[(1S,4R)-4-hydroperoxy-4-methylcyclohex-2-en-1-yl]propan-2-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9260434 | Reaxys |
| Citations |
|---|