EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O3 |
| Net Charge | 0 |
| Average Mass | 310.393 |
| Monoisotopic Mass | 310.15689 |
| SMILES | COc1cc(CC/C=C/C(=O)CCc2ccccc2)ccc1O |
| InChI | InChI=1S/C20H22O3/c1-23-20-15-17(12-14-19(20)22)9-5-6-10-18(21)13-11-16-7-3-2-4-8-16/h2-4,6-8,10,12,14-15,22H,5,9,11,13H2,1H3/b10-6+ |
| InChIKey | NOHMOWQGVDSLNY-UXBLZVDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia officinarum (ncbitaxon:199623) | |||
| rhizome (BTO:0001181) | PubMed (18484537) | ||
| root (BTO:0001188) | PubMed (18484537) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-1-phenyl-4E-heptene-3-one (CHEBI:66034) has role antineoplastic agent (CHEBI:35610) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-1-phenyl-4E-heptene-3-one (CHEBI:66034) has role plant metabolite (CHEBI:76924) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-1-phenyl-4E-heptene-3-one (CHEBI:66034) is a enone (CHEBI:51689) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-1-phenyl-4E-heptene-3-one (CHEBI:66034) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| (4E)-7-(4-hydroxy-3-methoxyphenyl)-1-phenylhept-4-en-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5445787 | Reaxys |
| CAS:79559-60-7 | ChemIDplus |
| Citations |
|---|