EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O4 |
| Net Charge | 0 |
| Average Mass | 342.435 |
| Monoisotopic Mass | 342.18311 |
| SMILES | COc1cc(CC[C@H](CC(=O)CCc2ccccc2)OC)ccc1O |
| InChI | InChI=1S/C21H26O4/c1-24-19(12-9-17-10-13-20(23)21(14-17)25-2)15-18(22)11-8-16-6-4-3-5-7-16/h3-7,10,13-14,19,23H,8-9,11-12,15H2,1-2H3/t19-/m1/s1 |
| InChIKey | XYIISUAVSYEQLI-LJQANCHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia officinarum (ncbitaxon:199623) | |||
| rhizome (BTO:0001181) | PubMed (18484537) | ||
| root (BTO:0001188) | PubMed (18484537) |
| Roles Classification |
|---|
| Biological Roles: | prostaglandin antagonist A compound that inhibits the action of prostaglandins. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | prostaglandin antagonist A compound that inhibits the action of prostaglandins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone (CHEBI:66032) has role antineoplastic agent (CHEBI:35610) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone (CHEBI:66032) has role plant metabolite (CHEBI:76924) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone (CHEBI:66032) has role prostaglandin antagonist (CHEBI:49023) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone (CHEBI:66032) is a guaiacols (CHEBI:134251) |
| 7-(4''-hydroxy-3''-methoxyphenyl)-5-methoxy-1-phenyl-3-heptanone (CHEBI:66032) is a ketone (CHEBI:17087) |
| IUPAC Name |
|---|
| (5R)-7-(4-hydroxy-3-methoxyphenyl)-5-methoxy-1-phenylheptan-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18567996 | Reaxys |
| Citations |
|---|