EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | COc1cc(O)c2c(c1/C=C/C(C)=O)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C20H18O5/c1-12(21)8-9-14-18(24-2)11-16(23)19-15(22)10-17(25-20(14)19)13-6-4-3-5-7-13/h3-9,11,17,23H,10H2,1-2H3/b9-8+/t17-/m0/s1 |
| InChIKey | GAGKUHAKUBMORD-IJDCCNJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia toxicaria (IPNI:520970-1) | stem (BTO:0001300) | PubMed (14510590) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) has functional parent (2S)-flavanone (CHEBI:15606) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) has role antineoplastic agent (CHEBI:35610) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) has role metabolite (CHEBI:25212) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) is a aromatic ketone (CHEBI:76224) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) is a enone (CHEBI:51689) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) is a methyl ketone (CHEBI:51867) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) is a monohydroxyflavanone (CHEBI:38748) |
| (2S)-5-Hydroxy-7-methoxy-8-[(E)-3-oxo-1-butenyl]flavanone (CHEBI:66031) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-7-methoxy-8-[(1E)-3-oxobut-1-en-1-yl]-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Citations |
|---|