EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO3S |
| Net Charge | 0 |
| Average Mass | 211.242 |
| Monoisotopic Mass | 211.03031 |
| SMILES | O=C1CSc2cc(O)cc(CO)c2N1 |
| InChI | InChI=1S/C9H9NO3S/c11-3-5-1-6(12)2-7-9(5)10-8(13)4-14-7/h1-2,11-12H,3-4H2,(H,10,13) |
| InChIKey | CZXYFHNORNVRJZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ampelomyces (ncbitaxon:50729) | - | PubMed (18603789) | Strain: SC0307 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxy-5-hydroxymethyl-2H-benzo[1,4]thiazin-3-one (CHEBI:66030) has role antibacterial agent (CHEBI:33282) |
| 7-hydroxy-5-hydroxymethyl-2H-benzo[1,4]thiazin-3-one (CHEBI:66030) has role metabolite (CHEBI:25212) |
| 7-hydroxy-5-hydroxymethyl-2H-benzo[1,4]thiazin-3-one (CHEBI:66030) is a benzothiazine (CHEBI:46899) |
| 7-hydroxy-5-hydroxymethyl-2H-benzo[1,4]thiazin-3-one (CHEBI:66030) is a benzyl alcohols (CHEBI:22743) |
| 7-hydroxy-5-hydroxymethyl-2H-benzo[1,4]thiazin-3-one (CHEBI:66030) is a lactam (CHEBI:24995) |
| 7-hydroxy-5-hydroxymethyl-2H-benzo[1,4]thiazin-3-one (CHEBI:66030) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 7-hydroxy-5-(hydroxymethyl)-2H-1,4-benzothiazin-3(4H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18590033 | Reaxys |
| Citations |
|---|