EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | CC(O)c1cc2c(o1)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C14H10O5/c1-6(15)10-5-8-12(17)7-3-2-4-9(16)11(7)13(18)14(8)19-10/h2-6,15-16H,1H3 |
| InChIKey | CKCXAMWUYPZVFL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kigelia pinnata (ncbitaxon:70070) | - | DOI (10.1016/0031-9422(81)80128-8) | |
| Tabebuia barbata (IPNI:248629-2) | bark (BTO:0001301) | PubMed (9567326) | (+)-enantiomer |
| Tabebuia impetiginosa (ncbitaxon:429701) | - | DOI (10.1039/P19910002323) | Mixture of 5- and 8-hydroxy regioisomers |
| Tabebuia incana (IPNI:248702-2) | bark (BTO:0001301) | DOI (10.1590/S0044-59672007000100011) | Nonseperated mixture of 5- and 8-hydroxy regioisomers |
| Tabebuia ochracea ssp neochrysantha (ncbitaxon:429707) | stem (BTO:0001300) | DOI (10.1076/phbi.35.4.227.13306) | Nonseperated mixture of 5- and 8-hydroxy regioisomers |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-hydroxy-2-(1'-hydroxyethyl)naphtho-[2,3-b]-furan-4,9-dione (CHEBI:66029) has role antineoplastic agent (CHEBI:35610) |
| 8-hydroxy-2-(1'-hydroxyethyl)naphtho-[2,3-b]-furan-4,9-dione (CHEBI:66029) has role metabolite (CHEBI:25212) |
| 8-hydroxy-2-(1'-hydroxyethyl)naphtho-[2,3-b]-furan-4,9-dione (CHEBI:66029) is a p-quinones (CHEBI:25830) |
| 8-hydroxy-2-(1'-hydroxyethyl)naphtho-[2,3-b]-furan-4,9-dione (CHEBI:66029) is a naphthofuran (CHEBI:39270) |
| 8-hydroxy-2-(1'-hydroxyethyl)naphtho-[2,3-b]-furan-4,9-dione (CHEBI:66029) is a phenols (CHEBI:33853) |
| 8-hydroxy-2-(1'-hydroxyethyl)naphtho-[2,3-b]-furan-4,9-dione (CHEBI:66029) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 8-hydroxy-2-(1-hydroxyethyl)naphtho[2,3-b]furan-4,9-dione |
| Synonym | Source |
|---|---|
| 8-hydroxy-2-(1-hydroxyethyl)benzo[f][1]benzofuran-4,9-dione | ChEBI |
| Citations |
|---|