EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O3 |
| Net Charge | 0 |
| Average Mass | 322.489 |
| Monoisotopic Mass | 322.25079 |
| SMILES | [H][C@@]12C[C@@H](OO)C(=C)[C@H](CC[C@@](C)(O)C=C)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H34O3/c1-7-19(5,21)12-9-15-14(2)16(23-22)13-17-18(3,4)10-8-11-20(15,17)6/h7,15-17,21-22H,1-2,8-13H2,3-6H3/t15-,16+,17-,19-,20+/m0/s1 |
| InChIKey | FVWMAXFFGJNFQF-SQIBXOBRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aster spathulifolius (ncbitaxon:947974) | aerial part (BTO:0001658) | PubMed (17121178) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α-hydroperoxy manool (CHEBI:66025) has role antineoplastic agent (CHEBI:35610) |
| 7α-hydroperoxy manool (CHEBI:66025) has role metabolite (CHEBI:25212) |
| 7α-hydroperoxy manool (CHEBI:66025) is a labdane diterpenoid (CHEBI:36770) |
| 7α-hydroperoxy manool (CHEBI:66025) is a peroxol (CHEBI:35924) |
| 7α-hydroperoxy manool (CHEBI:66025) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3R)-5-[(1R,3R,4aS,8aS)-3-hydroperoxy-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]-3-methylpent-1-en-3-ol |
| Synonym | Source |
|---|---|
| 7α-hydroperoxy-labda-8(17),14-dien-13(R)-ol | ChEBI |
| Citations |
|---|