EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H47N3O |
| Net Charge | 0 |
| Average Mass | 405.671 |
| Monoisotopic Mass | 405.37191 |
| SMILES | [H][C@]12CC[C@@H](C)[C@@]13CC[C@@]1(C)O[C@]2(C)[C@@H](NCCCCN(C)CCCN(C)C)[C@@]1([H])C3 |
| InChI | InChI=1S/C25H47N3O/c1-19-10-11-21-24(3)22(20-18-25(19,21)13-12-23(20,2)29-24)26-14-7-8-16-28(6)17-9-15-27(4)5/h19-22,26H,7-18H2,1-6H3/t19-,20-,21-,22+,23-,24+,25+/m1/s1 |
| InChIKey | JIRJLWLQLDLWSW-XNDBBLGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetosphaeronema hispidulum (ncbitaxon:565418) | - | PubMed (7509787) | Strain: NR 7127 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor that interferes with the action of phosphatidylinositol-specific phospholipase C (EC 3.1.4.11). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hispidospermidin (CHEBI:66017) has role EC 3.1.4.11 (phosphoinositide phospholipase C) inhibitor (CHEBI:64763) |
| hispidospermidin (CHEBI:66017) has role metabolite (CHEBI:25212) |
| hispidospermidin (CHEBI:66017) is a bridged compound (CHEBI:35990) |
| hispidospermidin (CHEBI:66017) is a cyclic ether (CHEBI:37407) |
| hispidospermidin (CHEBI:66017) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[3-(dimethylamino)propyl]-N-methyl-N'-[(3R,3aS,6R,7R,8S,9S,9aS)-3,6,9-trimethyldecahydro-6,9-epoxy-3a,7-methanocyclopenta[8]annulen-8-yl]butane-1,4-diamine |
| Synonym | Source |
|---|---|
| (−)-hispidospermidin | ChEBI |
| Citations |
|---|