EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O7 |
| Net Charge | 0 |
| Average Mass | 444.524 |
| Monoisotopic Mass | 444.21480 |
| SMILES | [H][C@]12[C@@H](O)c3c(oc(/C=C/C=C/C)cc3=O)O[C@]1(C)CC[C@@]1(O)C(C)(C)[C@]3(O)CC[C@]21CO3 |
| InChI | InChI=1S/C25H32O7/c1-5-6-7-8-15-13-16(26)17-18(27)19-22(4,32-20(17)31-15)9-11-24(28)21(2,3)25(29)12-10-23(19,24)14-30-25/h5-8,13,18-19,27-29H,9-12,14H2,1-4H3/b6-5+,8-7+/t18-,19-,22+,23-,24+,25-/m0/s1 |
| InChIKey | LFPBILWIIIPSMS-IEBSNVMFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (15387518) |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hesseltin A (CHEBI:66013) has role Penicillium metabolite (CHEBI:76964) |
| hesseltin A (CHEBI:66013) has role antiviral agent (CHEBI:22587) |
| hesseltin A (CHEBI:66013) is a bridged compound (CHEBI:35990) |
| hesseltin A (CHEBI:66013) is a cyclic ether (CHEBI:37407) |
| hesseltin A (CHEBI:66013) is a cyclic ketone (CHEBI:3992) |
| hesseltin A (CHEBI:66013) is a ketene acetal (CHEBI:145408) |
| hesseltin A (CHEBI:66013) is a organic heteropentacyclic compound (CHEBI:38164) |
| hesseltin A (CHEBI:66013) is a secondary alcohol (CHEBI:35681) |
| hesseltin A (CHEBI:66013) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3S,4aS,6aR,12R,12aS,12bR)-3,4a,12-trihydroxy-4,4,6a-trimethyl-9-[(1E,3E)-penta-1,3-dien-1-yl]-1,2,3,4,4a,5,6,6a,12,12a-decahydro-11H-3,12b-(epoxymethano)benzo[f]pyrano[2,3-b]chromen-11-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9883602 | Reaxys |
| Citations |
|---|