EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O3 |
| Net Charge | 0 |
| Average Mass | 314.425 |
| Monoisotopic Mass | 314.18819 |
| SMILES | [H][C@@]12C(=O)C=C(C)[C@](O)(/C=C/c3ccoc3)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H26O3/c1-14-12-16(21)17-18(2,3)8-5-9-19(17,4)20(14,22)10-6-15-7-11-23-13-15/h6-7,10-13,17,22H,5,8-9H2,1-4H3/b10-6+/t17-,19-,20+/m0/s1 |
| InChIKey | USWFVTHYLJICBA-DYBKDBSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hedychium spicatum (ncbitaxon:110723) | rhizome (BTO:0001181) | PubMed (19027298) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-hydroxy hedychenone (CHEBI:66010) has role antineoplastic agent (CHEBI:35610) |
| 9-hydroxy hedychenone (CHEBI:66010) has role metabolite (CHEBI:25212) |
| 9-hydroxy hedychenone (CHEBI:66010) is a enone (CHEBI:51689) |
| 9-hydroxy hedychenone (CHEBI:66010) is a furans (CHEBI:24129) |
| 9-hydroxy hedychenone (CHEBI:66010) is a hexahydronaphthalenes (CHEBI:142348) |
| 9-hydroxy hedychenone (CHEBI:66010) is a labdane diterpenoid (CHEBI:36770) |
| 9-hydroxy hedychenone (CHEBI:66010) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (4R,4aS,8aS)-4-[(E)-2-(furan-3-yl)ethenyl]-4-hydroxy-3,4a,8,8-tetramethyl-4a,5,6,7,8,8a-hexahydronaphthalen-1(4H)-one |
| Synonym | Source |
|---|---|
| 9-hydroxy-15,16-epoxy-7,11,13(16)14-labdatetraen-6-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19010942 | Reaxys |
| Citations |
|---|