EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O4 |
| Net Charge | 0 |
| Average Mass | 330.424 |
| Monoisotopic Mass | 330.18311 |
| SMILES | [H][C@]1(/C=C/C2=CC(=O)OC2)C(C)=C(O)C(=O)[C@@]2([H])C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C20H26O4/c1-12-14(7-6-13-10-15(21)24-11-13)20(4)9-5-8-19(2,3)18(20)17(23)16(12)22/h6-7,10,14,18,22H,5,8-9,11H2,1-4H3/b7-6+/t14-,18-,20+/m0/s1 |
| InChIKey | CGTQDMWGKOVCFZ-TYUXXYNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hedychium spicatum (ncbitaxon:110723) | rhizome (BTO:0001181) | PubMed (19027298) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hedychilactone D (CHEBI:66009) has role antineoplastic agent (CHEBI:35610) |
| hedychilactone D (CHEBI:66009) has role metabolite (CHEBI:25212) |
| hedychilactone D (CHEBI:66009) is a butenolide (CHEBI:50523) |
| hedychilactone D (CHEBI:66009) is a enol (CHEBI:33823) |
| hedychilactone D (CHEBI:66009) is a enone (CHEBI:51689) |
| hedychilactone D (CHEBI:66009) is a labdane diterpenoid (CHEBI:36770) |
| hedychilactone D (CHEBI:66009) is a octahydronaphthalenes (CHEBI:138397) |
| IUPAC Name |
|---|
| 4-{(E)-2-[(1R,4aS,8aR)-3-hydroxy-2,5,5,8a-tetramethyl-4-oxo-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]ethenyl}furan-2(5H)-one |
| Synonym | Source |
|---|---|
| 7-hydroxy,6-oxo-7,11,13-labdatrien-16,15-olide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19010943 | Reaxys |
| Citations |
|---|