EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O3 |
| Net Charge | 0 |
| Average Mass | 294.395 |
| Monoisotopic Mass | 294.19434 |
| SMILES | [H][C@]12C/C(=C(\C)C(=O)O)[C@](O)(C[C@]3(C)[C@H](N)CC[C@@]31C)N2C |
| InChI | InChI=1S/C16H26N2O3/c1-9(13(19)20)10-7-12-14(2)6-5-11(17)15(14,3)8-16(10,21)18(12)4/h11-12,21H,5-8,17H2,1-4H3,(H,19,20)/b10-9-/t11-,12+,14-,15-,16-/m1/s1 |
| InChIKey | VESMUQGSQBZLLK-SQWIVPEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glechoma hederacea (ncbitaxon:28509) | aerial part (BTO:0001658) | DOI (10.1016/S0040-4020(03)01093-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hederacine A (CHEBI:66007) has role metabolite (CHEBI:25212) |
| hederacine A (CHEBI:66007) is a alkaloid (CHEBI:22315) |
| hederacine A (CHEBI:66007) is a monocarboxylic acid (CHEBI:25384) |
| hederacine A (CHEBI:66007) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2Z)-2-[(1R,3aS,4S,7R,8aS)-1-amino-7-hydroxy-3a,8a,9-trimethyloctahydro-4,7-epiminoazulen-6(1H)-ylidene]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9176084 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9514523 | Reaxys |