EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | C/C=C/C=C/C1=CC2=C(CO1)C(=O)[C@](C)(O)[C@H](O)C2 |
| InChI | InChI=1S/C15H18O4/c1-3-4-5-6-11-7-10-8-13(16)15(2,18)14(17)12(10)9-19-11/h3-7,13,16,18H,8-9H2,1-2H3/b4-3+,6-5+/t13-,15-/m1/s1 |
| InChIKey | GFTDIFRKHSPLIX-VNLWOOSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma harzianum (ncbitaxon:5544) | - | PubMed (8968392) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| harziphilone (CHEBI:66006) has role anti-HIV agent (CHEBI:64946) |
| harziphilone (CHEBI:66006) has role metabolite (CHEBI:25212) |
| harziphilone (CHEBI:66006) is a aromatic ketone (CHEBI:76224) |
| harziphilone (CHEBI:66006) is a diol (CHEBI:23824) |
| harziphilone (CHEBI:66006) is a enone (CHEBI:51689) |
| harziphilone (CHEBI:66006) is a isochromanes (CHEBI:38762) |
| harziphilone (CHEBI:66006) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| rel-(6R,7R)-6,7-dihydroxy-7-methyl-3-[(1E,3E)-penta-1,3-dien-1-yl]-1,5,6,7-tetrahydro-8H-isochromen-8-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7590687 | Reaxys |
| CAS:183239-75-0 | ChemIDplus |
| Citations |
|---|