EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O2 |
| Net Charge | 0 |
| Average Mass | 428.701 |
| Monoisotopic Mass | 428.36543 |
| SMILES | [H][C@@]12C=CC3=C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@H](O)C[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H48O2/c1-7-20(18(2)3)16-27(31)19(4)24-10-11-25-23-9-8-21-17-22(30)12-14-28(21,5)26(23)13-15-29(24,25)6/h8-9,17-20,22-27,30-31H,7,10-16H2,1-6H3/t19-,20+,22-,23-,24+,25-,26-,27+,28-,29+/m0/s1 |
| InChIKey | CEUDUKDULPDRSW-JDVKSECFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Haloxylon recurvum (IPNI:165851-1) | whole plant (BTO:0001461) | PubMed (16651755) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| halosterol B (CHEBI:65999) has parent hydride stigmastane (CHEBI:26773) |
| halosterol B (CHEBI:65999) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| halosterol B (CHEBI:65999) has role metabolite (CHEBI:25212) |
| halosterol B (CHEBI:65999) is a 22-hydroxy steroid (CHEBI:36863) |
| halosterol B (CHEBI:65999) is a 3β-hydroxy steroid (CHEBI:36836) |
| IUPAC Name |
|---|
| (3β,22R)-stigmasta-4,6-diene-3,22-diol |
| Synonym | Source |
|---|---|
| (22R,24R)-24-ethyl-cholest-4,6-diene-3β,22-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10396293 | Reaxys |
| Citations |
|---|