EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50O6 |
| Net Charge | 0 |
| Average Mass | 602.812 |
| Monoisotopic Mass | 602.36074 |
| SMILES | C=C(C)[C@H](CC=C(C)C)C[C@@]12C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C(C)C)(C(=O)C(C(=O)c3ccc(O)c(O)c3)=C1O)C2=O |
| InChI | InChI=1S/C38H50O6/c1-22(2)11-13-27(25(7)8)20-37-21-28(15-12-23(3)4)36(9,10)38(35(37)44,18-17-24(5)6)34(43)31(33(37)42)32(41)26-14-16-29(39)30(40)19-26/h11-12,14,16-17,19,27-28,39-40,42H,7,13,15,18,20-21H2,1-6,8-10H3/t27-,28-,37-,38+/m1/s1 |
| InChIKey | QDKLRKZQSOQWJQ-LPEHXNHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allanblackia stuhlmannii (IPNI:427050-1) | xylem (BTO:0001468) | PubMed (9917299) | Previous component: root wood; |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guttiferone F (CHEBI:65991) has role antileishmanial agent (CHEBI:70868) |
| guttiferone F (CHEBI:65991) has role apoptosis inducer (CHEBI:68495) |
| guttiferone F (CHEBI:65991) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| guttiferone F (CHEBI:65991) has role metabolite (CHEBI:25212) |
| guttiferone F (CHEBI:65991) is a benzophenones (CHEBI:22726) |
| guttiferone F (CHEBI:65991) is a bridged compound (CHEBI:35990) |
| guttiferone F (CHEBI:65991) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (1R,5R,7R)-3-(3,4-dihydroxybenzoyl)-4-hydroxy-8,8-dimethyl-1,7-bis(3-methylbut-2-en-1-yl)-5-[(2R)-5-methyl-2-(prop-1-en-2-yl)hex-4-en-1-yl]bicyclo[3.3.1]non-3-ene-2,9-dione |
| Manual Xrefs | Databases |
|---|---|
| 10282668 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4731414 | Reaxys |
| Citations |
|---|